C24H34NO6P — CID 66642819
3-[4-[[4-hydroxy-3-(2-methylpropanoylamino)phenyl]methyl]-3,5-dimethylphenoxy]pentan-3-ylphosphonic acid (PubChem CID 66642819) has the molecular formula C24H34NO6P and a molecular weight of 463.51 g/mol. Its IUPAC name is 3-[4-[[4-hydroxy-3-(2-methylpropanoylamino)phenyl]methyl]-3,5-dimethylphenoxy]pentan-3-ylphosphonic acid.
| Compound Name | 3-[4-[[4-hydroxy-3-(2-methylpropanoylamino)phenyl]methyl]-3,5-dimethylphenoxy]pentan-3-ylphosphonic acid |
|---|---|
| PubChem CID | 66642819 |
| Molecular Formula | C24H34NO6P |
| Molecular Weight | 463.51 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | 3-[4-[[4-hydroxy-3-(2-methylpropanoylamino)phenyl]methyl]-3,5-dimethylphenoxy]pentan-3-ylphosphonic acid |
| SMILES | CCC(CC)(Oc1cc(C)c(Cc2ccc(O)c(NC(=O)C(C)C)c2)c(C)c1)P(=O)(O)O |
| InChI | InChI=1S/C24H34NO6P/c1-7-24(8-2,32(28,29)30)31-19-11-16(5)20(17(6)12-19)13-18-9-10-22(26)21(14-18)25-23(27)15(3)4/h9-12,14-15,26H,7-8,13H2,1-6H3,(H,25,27)(H2,28,29,30) |
| InChIKey | JJZWJOLCCOAQJP-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.51 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|