C22H32NO6P — CID 66642993
3-[4-[[3-amino-4-(methoxymethoxy)phenyl]methyl]-3,5-dimethylphenoxy]pentan-3-ylphosphonic acid (PubChem CID 66642993) has the molecular formula C22H32NO6P and a molecular weight of 437.47 g/mol. Its IUPAC name is 3-[4-[[3-amino-4-(methoxymethoxy)phenyl]methyl]-3,5-dimethylphenoxy]pentan-3-ylphosphonic acid.
| Compound Name | 3-[4-[[3-amino-4-(methoxymethoxy)phenyl]methyl]-3,5-dimethylphenoxy]pentan-3-ylphosphonic acid |
|---|---|
| PubChem CID | 66642993 |
| Molecular Formula | C22H32NO6P |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 3-[4-[[3-amino-4-(methoxymethoxy)phenyl]methyl]-3,5-dimethylphenoxy]pentan-3-ylphosphonic acid |
| SMILES | CCC(CC)(Oc1cc(C)c(Cc2ccc(OCOC)c(N)c2)c(C)c1)P(=O)(O)O |
| InChI | InChI=1S/C22H32NO6P/c1-6-22(7-2,30(24,25)26)29-18-10-15(3)19(16(4)11-18)12-17-8-9-21(20(23)13-17)28-14-27-5/h8-11,13H,6-7,12,14,23H2,1-5H3,(H2,24,25,26) |
| InChIKey | UNCOTHCAOURMPO-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|