C23H34NO4P — CID 90724788
[4-[(4-amino-3-propan-2-ylphenyl)methyl]-3,5-dimethylphenyl]peroxy-pentan-3-ylphosphinic acid (PubChem CID 90724788) has the molecular formula C23H34NO4P and a molecular weight of 419.50 g/mol. Its IUPAC name is [4-[(4-amino-3-propan-2-ylphenyl)methyl]-3,5-dimethylphenyl]peroxy-pentan-3-ylphosphinic acid.
| Compound Name | [4-[(4-amino-3-propan-2-ylphenyl)methyl]-3,5-dimethylphenyl]peroxy-pentan-3-ylphosphinic acid |
|---|---|
| PubChem CID | 90724788 |
| Molecular Formula | C23H34NO4P |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | [4-[(4-amino-3-propan-2-ylphenyl)methyl]-3,5-dimethylphenyl]peroxy-pentan-3-ylphosphinic acid |
| SMILES | CCC(CC)P(=O)(O)OOc1cc(C)c(Cc2ccc(N)c(C(C)C)c2)c(C)c1 |
| InChI | InChI=1S/C23H34NO4P/c1-7-20(8-2)29(25,26)28-27-19-11-16(5)22(17(6)12-19)14-18-9-10-23(24)21(13-18)15(3)4/h9-13,15,20H,7-8,14,24H2,1-6H3,(H,25,26) |
| InChIKey | QXOOVWIKRJIFDD-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|