C27H30FO6P — CID 91120000
[4-[[3-(4-fluorobenzoyl)-4-hydroxyphenyl]methyl]-3,5-dimethylphenyl]peroxy-pentan-3-ylphosphinic acid (PubChem CID 91120000) has the molecular formula C27H30FO6P and a molecular weight of 500.50 g/mol. Its IUPAC name is [4-[[3-(4-fluorobenzoyl)-4-hydroxyphenyl]methyl]-3,5-dimethylphenyl]peroxy-pentan-3-ylphosphinic acid.
| Compound Name | [4-[[3-(4-fluorobenzoyl)-4-hydroxyphenyl]methyl]-3,5-dimethylphenyl]peroxy-pentan-3-ylphosphinic acid |
|---|---|
| PubChem CID | 91120000 |
| Molecular Formula | C27H30FO6P |
| Molecular Weight | 500.50 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | [4-[[3-(4-fluorobenzoyl)-4-hydroxyphenyl]methyl]-3,5-dimethylphenyl]peroxy-pentan-3-ylphosphinic acid |
| SMILES | CCC(CC)P(=O)(O)OOc1cc(C)c(Cc2ccc(O)c(C(=O)c3ccc(F)cc3)c2)c(C)c1 |
| InChI | InChI=1S/C27H30FO6P/c1-5-23(6-2)35(31,32)34-33-22-13-17(3)24(18(4)14-22)15-19-7-12-26(29)25(16-19)27(30)20-8-10-21(28)11-9-20/h7-14,16,23,29H,5-6,15H2,1-4H3,(H,31,32) |
| InChIKey | LWSBUSGPIYBXAI-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.50 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|