C23H33O5P — CID 91092287
[4-[(4-hydroxy-2-methyl-3-propan-2-ylphenyl)methyl]-3-methylphenyl]peroxy-pentan-3-ylphosphinic acid (PubChem CID 91092287) has the molecular formula C23H33O5P and a molecular weight of 420.49 g/mol. Its IUPAC name is [4-[(4-hydroxy-2-methyl-3-propan-2-ylphenyl)methyl]-3-methylphenyl]peroxy-pentan-3-ylphosphinic acid.
| Compound Name | [4-[(4-hydroxy-2-methyl-3-propan-2-ylphenyl)methyl]-3-methylphenyl]peroxy-pentan-3-ylphosphinic acid |
|---|---|
| PubChem CID | 91092287 |
| Molecular Formula | C23H33O5P |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | [4-[(4-hydroxy-2-methyl-3-propan-2-ylphenyl)methyl]-3-methylphenyl]peroxy-pentan-3-ylphosphinic acid |
| SMILES | CCC(CC)P(=O)(O)OOc1ccc(Cc2ccc(O)c(C(C)C)c2C)c(C)c1 |
| InChI | InChI=1S/C23H33O5P/c1-7-21(8-2)29(25,26)28-27-20-11-9-18(16(5)13-20)14-19-10-12-22(24)23(15(3)4)17(19)6/h9-13,15,21,24H,7-8,14H2,1-6H3,(H,25,26) |
| InChIKey | JOPQPCFOSMCBLP-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|