C24H24ClFO2 — CID 170081193
4-[(2-chloro-6-methyl-4-phenylmethoxyphenyl)methyl]-3-fluoro-2-propan-2-ylphenol (PubChem CID 170081193) has the molecular formula C24H24ClFO2 and a molecular weight of 398.91 g/mol. Its IUPAC name is 4-[(2-chloro-6-methyl-4-phenylmethoxyphenyl)methyl]-3-fluoro-2-propan-2-ylphenol.
| Compound Name | 4-[(2-chloro-6-methyl-4-phenylmethoxyphenyl)methyl]-3-fluoro-2-propan-2-ylphenol |
|---|---|
| PubChem CID | 170081193 |
| Molecular Formula | C24H24ClFO2 |
| Molecular Weight | 398.91 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 4-[(2-chloro-6-methyl-4-phenylmethoxyphenyl)methyl]-3-fluoro-2-propan-2-ylphenol |
| SMILES | Cc1cc(OCc2ccccc2)cc(Cl)c1Cc1ccc(O)c(C(C)C)c1F |
| InChI | InChI=1S/C24H24ClFO2/c1-15(2)23-22(27)10-9-18(24(23)26)12-20-16(3)11-19(13-21(20)25)28-14-17-7-5-4-6-8-17/h4-11,13,15,27H,12,14H2,1-3H3 |
| InChIKey | RKBAPCICJRBLOE-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.91 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |