C19H18Cl2F4O5S — CID 169008694
[3,5-dichloro-4-[[2-fluoro-4-(methoxymethoxy)-3-propan-2-ylphenyl]methyl]phenyl] trifluoromethanesulfonate (PubChem CID 169008694) has the molecular formula C19H18Cl2F4O5S and a molecular weight of 505.31 g/mol. Its IUPAC name is [3,5-dichloro-4-[[2-fluoro-4-(methoxymethoxy)-3-propan-2-ylphenyl]methyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [3,5-dichloro-4-[[2-fluoro-4-(methoxymethoxy)-3-propan-2-ylphenyl]methyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 169008694 |
| Molecular Formula | C19H18Cl2F4O5S |
| Molecular Weight | 505.31 g/mol |
| Exact Mass | 504.02 |
| IUPAC Name | [3,5-dichloro-4-[[2-fluoro-4-(methoxymethoxy)-3-propan-2-ylphenyl]methyl]phenyl] trifluoromethanesulfonate |
| SMILES | COCOc1ccc(Cc2c(Cl)cc(OS(=O)(=O)C(F)(F)F)cc2Cl)c(F)c1C(C)C |
| InChI | InChI=1S/C19H18Cl2F4O5S/c1-10(2)17-16(29-9-28-3)5-4-11(18(17)22)6-13-14(20)7-12(8-15(13)21)30-31(26,27)19(23,24)25/h4-5,7-8,10H,6,9H2,1-3H3 |
| InChIKey | HTHHOKGMIDOLRK-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.31 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|