C19H19F3N2O8S2 — CID 18456955
[4-[2-[(5-cyano-2-methoxyphenyl)sulfonylamino]ethyl]-3-(methoxymethoxy)phenyl] trifluoromethanesulfonate (PubChem CID 18456955) has the molecular formula C19H19F3N2O8S2 and a molecular weight of 524.50 g/mol. Its IUPAC name is [4-[2-[(5-cyano-2-methoxyphenyl)sulfonylamino]ethyl]-3-(methoxymethoxy)phenyl] trifluoromethanesulfonate.
| Compound Name | [4-[2-[(5-cyano-2-methoxyphenyl)sulfonylamino]ethyl]-3-(methoxymethoxy)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 18456955 |
| Molecular Formula | C19H19F3N2O8S2 |
| Molecular Weight | 524.50 g/mol |
| Exact Mass | 524.05 |
| IUPAC Name | [4-[2-[(5-cyano-2-methoxyphenyl)sulfonylamino]ethyl]-3-(methoxymethoxy)phenyl] trifluoromethanesulfonate |
| SMILES | COCOc1cc(OS(=O)(=O)C(F)(F)F)ccc1CCNS(=O)(=O)c1cc(C#N)ccc1OC |
| InChI | InChI=1S/C19H19F3N2O8S2/c1-29-12-31-17-10-15(32-34(27,28)19(20,21)22)5-4-14(17)7-8-24-33(25,26)18-9-13(11-23)3-6-16(18)30-2/h3-6,9-10,24H,7-8,12H2,1-2H3 |
| InChIKey | GFIZUCVGWGFWLK-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 141.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.50 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|