C26H28N2O4S — CID 18457002
5-cyano-2-methoxy-N-[2-(2-phenylmethoxy-4-propan-2-ylphenyl)ethyl]benzenesulfonamide (PubChem CID 18457002) has the molecular formula C26H28N2O4S and a molecular weight of 464.59 g/mol. Its IUPAC name is 5-cyano-2-methoxy-N-[2-(2-phenylmethoxy-4-propan-2-ylphenyl)ethyl]benzenesulfonamide.
| Compound Name | 5-cyano-2-methoxy-N-[2-(2-phenylmethoxy-4-propan-2-ylphenyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 18457002 |
| Molecular Formula | C26H28N2O4S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | 5-cyano-2-methoxy-N-[2-(2-phenylmethoxy-4-propan-2-ylphenyl)ethyl]benzenesulfonamide |
| SMILES | COc1ccc(C#N)cc1S(=O)(=O)NCCc1ccc(C(C)C)cc1OCc1ccccc1 |
| InChI | InChI=1S/C26H28N2O4S/c1-19(2)23-11-10-22(25(16-23)32-18-20-7-5-4-6-8-20)13-14-28-33(29,30)26-15-21(17-27)9-12-24(26)31-3/h4-12,15-16,19,28H,13-14,18H2,1-3H3 |
| InChIKey | LXWFOCSUSKWFMP-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |