C24H21F3N2O5S — CID 18456964
5-cyano-2-methoxy-N-[2-[2-(methoxymethoxy)-4-(3,4,5-trifluorophenyl)phenyl]ethyl]benzenesulfonamide (PubChem CID 18456964) has the molecular formula C24H21F3N2O5S and a molecular weight of 506.50 g/mol. Its IUPAC name is 5-cyano-2-methoxy-N-[2-[2-(methoxymethoxy)-4-(3,4,5-trifluorophenyl)phenyl]ethyl]benzenesulfonamide.
| Compound Name | 5-cyano-2-methoxy-N-[2-[2-(methoxymethoxy)-4-(3,4,5-trifluorophenyl)phenyl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 18456964 |
| Molecular Formula | C24H21F3N2O5S |
| Molecular Weight | 506.50 g/mol |
| Exact Mass | 506.11 |
| IUPAC Name | 5-cyano-2-methoxy-N-[2-[2-(methoxymethoxy)-4-(3,4,5-trifluorophenyl)phenyl]ethyl]benzenesulfonamide |
| SMILES | COCOc1cc(-c2cc(F)c(F)c(F)c2)ccc1CCNS(=O)(=O)c1cc(C#N)ccc1OC |
| InChI | InChI=1S/C24H21F3N2O5S/c1-32-14-34-22-12-17(18-10-19(25)24(27)20(26)11-18)5-4-16(22)7-8-29-35(30,31)23-9-15(13-28)3-6-21(23)33-2/h3-6,9-12,29H,7-8,14H2,1-2H3 |
| InChIKey | QMUNILBXERZVSQ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.50 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|