C18H20N2O7S — CID 141075702
(5-cyano-2-methoxyphenyl)-[2-[4-hydroxy-2-(methoxymethoxy)phenyl]ethyl]sulfamic acid (PubChem CID 141075702) has the molecular formula C18H20N2O7S and a molecular weight of 408.43 g/mol. Its IUPAC name is (5-cyano-2-methoxyphenyl)-[2-[4-hydroxy-2-(methoxymethoxy)phenyl]ethyl]sulfamic acid.
| Compound Name | (5-cyano-2-methoxyphenyl)-[2-[4-hydroxy-2-(methoxymethoxy)phenyl]ethyl]sulfamic acid |
|---|---|
| PubChem CID | 141075702 |
| Molecular Formula | C18H20N2O7S |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | (5-cyano-2-methoxyphenyl)-[2-[4-hydroxy-2-(methoxymethoxy)phenyl]ethyl]sulfamic acid |
| SMILES | COCOc1cc(O)ccc1CCN(c1cc(C#N)ccc1OC)S(=O)(=O)O |
| InChI | InChI=1S/C18H20N2O7S/c1-25-12-27-18-10-15(21)5-4-14(18)7-8-20(28(22,23)24)16-9-13(11-19)3-6-17(16)26-2/h3-6,9-10,21H,7-8,12H2,1-2H3,(H,22,23,24) |
| InChIKey | JLKUTFFCPKPLLR-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 129.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|