C20H17F9N2O11S4 — CID 90712304
[4-[2-[(5-isocyano-2-methoxyphenyl)sulfonylamino]ethyl]-3-methylphenyl] trifluoromethanesulfonate;trifluoromethylsulfonyl trifluoromethanesulfonate (PubChem CID 90712304) has the molecular formula C20H17F9N2O11S4 and a molecular weight of 760.61 g/mol. Its IUPAC name is [4-[2-[(5-isocyano-2-methoxyphenyl)sulfonylamino]ethyl]-3-methylphenyl] trifluoromethanesulfonate;trifluoromethylsulfonyl trifluoromethanesulfonate.
| Compound Name | [4-[2-[(5-isocyano-2-methoxyphenyl)sulfonylamino]ethyl]-3-methylphenyl] trifluoromethanesulfonate;trifluoromethylsulfonyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 90712304 |
| Molecular Formula | C20H17F9N2O11S4 |
| Molecular Weight | 760.61 g/mol |
| Exact Mass | 759.96 |
| IUPAC Name | [4-[2-[(5-isocyano-2-methoxyphenyl)sulfonylamino]ethyl]-3-methylphenyl] trifluoromethanesulfonate;trifluoromethylsulfonyl trifluoromethanesulfonate |
| SMILES | O=S(=O)(OS(=O)(=O)C(F)(F)F)C(F)(F)F.[C-]#[N+]c1ccc(OC)c(S(=O)(=O)NCCc2ccc(OS(=O)(=O)C(F)(F)F)cc2C)c1 |
| InChI | InChI=1S/C18H17F3N2O6S2.C2F6O5S2/c1-12-10-15(29-31(26,27)18(19,20)21)6-4-13(12)8-9-23-30(24,25)17-11-14(22-2)5-7-16(17)28-3;3-1(4,5)14(9,10)13-15(11,12)2(6,7)8/h4-7,10-11,23H,8-9H2,1,3H3; |
| InChIKey | JHNVXJLNLUZWBR-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 180.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.61 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|