C8H2Cl2F6O6S2 — CID 142716906
[2,4-dichloro-5-(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate (PubChem CID 142716906) has the molecular formula C8H2Cl2F6O6S2 and a molecular weight of 443.13 g/mol. Its IUPAC name is [2,4-dichloro-5-(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate.
| Compound Name | [2,4-dichloro-5-(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 142716906 |
| Molecular Formula | C8H2Cl2F6O6S2 |
| Molecular Weight | 443.13 g/mol |
| Exact Mass | 441.86 |
| IUPAC Name | [2,4-dichloro-5-(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1cc(OS(=O)(=O)C(F)(F)F)c(Cl)cc1Cl)C(F)(F)F |
| InChI | InChI=1S/C8H2Cl2F6O6S2/c9-3-1-4(10)6(22-24(19,20)8(14,15)16)2-5(3)21-23(17,18)7(11,12)13/h1-2H |
| InChIKey | UEUVONGKCGKBGM-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.13 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|