C9H8ClF3N4O3S — CID 168591800
[2-chloro-4-[(diaminomethylidenehydrazinylidene)methyl]phenyl] trifluoromethanesulfonate (PubChem CID 168591800) has the molecular formula C9H8ClF3N4O3S and a molecular weight of 344.70 g/mol. Its IUPAC name is [2-chloro-4-[(diaminomethylidenehydrazinylidene)methyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [2-chloro-4-[(diaminomethylidenehydrazinylidene)methyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 168591800 |
| Molecular Formula | C9H8ClF3N4O3S |
| Molecular Weight | 344.70 g/mol |
| Exact Mass | 344.00 |
| IUPAC Name | [2-chloro-4-[(diaminomethylidenehydrazinylidene)methyl]phenyl] trifluoromethanesulfonate |
| SMILES | NC(N)=NN=Cc1ccc(OS(=O)(=O)C(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C9H8ClF3N4O3S/c10-6-3-5(4-16-17-8(14)15)1-2-7(6)20-21(18,19)9(11,12)13/h1-4H,(H4,14,15,17) |
| InChIKey | CTVDKPGYOAHTPM-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 120.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.70 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|