C9H7Cl2F3N4O3S — CID 146217229
[3,5-dichloro-4-[(diaminomethylidenehydrazinylidene)methyl]phenyl] trifluoromethanesulfonate (PubChem CID 146217229) has the molecular formula C9H7Cl2F3N4O3S and a molecular weight of 379.15 g/mol. Its IUPAC name is [3,5-dichloro-4-[(diaminomethylidenehydrazinylidene)methyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [3,5-dichloro-4-[(diaminomethylidenehydrazinylidene)methyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 146217229 |
| Molecular Formula | C9H7Cl2F3N4O3S |
| Molecular Weight | 379.15 g/mol |
| Exact Mass | 377.96 |
| IUPAC Name | [3,5-dichloro-4-[(diaminomethylidenehydrazinylidene)methyl]phenyl] trifluoromethanesulfonate |
| SMILES | NC(N)=NN=Cc1c(Cl)cc(OS(=O)(=O)C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C9H7Cl2F3N4O3S/c10-6-1-4(21-22(19,20)9(12,13)14)2-7(11)5(6)3-17-18-8(15)16/h1-3H,(H4,15,16,18) |
| InChIKey | JCCFQMNVZSJJLT-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 120.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.15 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|