C8H3F5O4S — CID 122583120
(3,5-difluoro-4-formylphenyl) trifluoromethanesulfonate (PubChem CID 122583120) has the molecular formula C8H3F5O4S and a molecular weight of 290.17 g/mol. Its IUPAC name is (3,5-difluoro-4-formylphenyl) trifluoromethanesulfonate.
| Compound Name | (3,5-difluoro-4-formylphenyl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 122583120 |
| Molecular Formula | C8H3F5O4S |
| Molecular Weight | 290.17 g/mol |
| Exact Mass | 289.97 |
| IUPAC Name | (3,5-difluoro-4-formylphenyl) trifluoromethanesulfonate |
| SMILES | O=Cc1c(F)cc(OS(=O)(=O)C(F)(F)F)cc1F |
| InChI | InChI=1S/C8H3F5O4S/c9-6-1-4(2-7(10)5(6)3-14)17-18(15,16)8(11,12)13/h1-3H |
| InChIKey | NBBXYVNEAPPDQO-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.17 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|