C16H17ClN4O — CID 87880605
2-[(E)-[3-chloro-4-(2-phenylethoxy)phenyl]methylideneamino]guanidine (PubChem CID 87880605) has the molecular formula C16H17ClN4O and a molecular weight of 316.79 g/mol. Its IUPAC name is 2-[(E)-[3-chloro-4-(2-phenylethoxy)phenyl]methylideneamino]guanidine.
| Compound Name | 2-[(E)-[3-chloro-4-(2-phenylethoxy)phenyl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 87880605 |
| Molecular Formula | C16H17ClN4O |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 2-[(E)-[3-chloro-4-(2-phenylethoxy)phenyl]methylideneamino]guanidine |
| SMILES | NC(N)=N/N=C/c1ccc(OCCc2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C16H17ClN4O/c17-14-10-13(11-20-21-16(18)19)6-7-15(14)22-9-8-12-4-2-1-3-5-12/h1-7,10-11H,8-9H2,(H4,18,19,21)/b20-11+ |
| InChIKey | LJMJAHTWTFBGEW-RGVLZGJSSA-N |
| XLogP | 2.57 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|