C16H15Cl3N4O2 — CID 168590615
2-[[4-methoxy-3-[(2,4,6-trichlorophenoxy)methyl]phenyl]methylideneamino]guanidine (PubChem CID 168590615) has the molecular formula C16H15Cl3N4O2 and a molecular weight of 401.68 g/mol. Its IUPAC name is 2-[[4-methoxy-3-[(2,4,6-trichlorophenoxy)methyl]phenyl]methylideneamino]guanidine.
| Compound Name | 2-[[4-methoxy-3-[(2,4,6-trichlorophenoxy)methyl]phenyl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 168590615 |
| Molecular Formula | C16H15Cl3N4O2 |
| Molecular Weight | 401.68 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | 2-[[4-methoxy-3-[(2,4,6-trichlorophenoxy)methyl]phenyl]methylideneamino]guanidine |
| SMILES | COc1ccc(C=NN=C(N)N)cc1COc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C16H15Cl3N4O2/c1-24-14-3-2-9(7-22-23-16(20)21)4-10(14)8-25-15-12(18)5-11(17)6-13(15)19/h2-7H,8H2,1H3,(H4,20,21,23) |
| InChIKey | SLTYFVJFWAWNDI-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.68 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|