C17H20N4O2 — CID 168593056
2-[[4-methoxy-3-[(4-methylphenoxy)methyl]phenyl]methylideneamino]guanidine (PubChem CID 168593056) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is 2-[[4-methoxy-3-[(4-methylphenoxy)methyl]phenyl]methylideneamino]guanidine.
| Compound Name | 2-[[4-methoxy-3-[(4-methylphenoxy)methyl]phenyl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 168593056 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 2-[[4-methoxy-3-[(4-methylphenoxy)methyl]phenyl]methylideneamino]guanidine |
| SMILES | COc1ccc(C=NN=C(N)N)cc1COc1ccc(C)cc1 |
| InChI | InChI=1S/C17H20N4O2/c1-12-3-6-15(7-4-12)23-11-14-9-13(5-8-16(14)22-2)10-20-21-17(18)19/h3-10H,11H2,1-2H3,(H4,18,19,21) |
| InChIKey | JSKKALMXZHFGAC-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|