C27H27N3O6 — CID 19298271
[(Z)-[amino-[4-(2-amino-2-oxoethoxy)phenyl]methylidene]amino] (Z)-3-[4-methoxy-3-[(4-methylphenoxy)methyl]phenyl]prop-2-enoate (PubChem CID 19298271) has the molecular formula C27H27N3O6 and a molecular weight of 489.53 g/mol. Its IUPAC name is [(Z)-[amino-[4-(2-amino-2-oxoethoxy)phenyl]methylidene]amino] (Z)-3-[4-methoxy-3-[(4-methylphenoxy)methyl]phenyl]prop-2-enoate.
| Compound Name | [(Z)-[amino-[4-(2-amino-2-oxoethoxy)phenyl]methylidene]amino] (Z)-3-[4-methoxy-3-[(4-methylphenoxy)methyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 19298271 |
| Molecular Formula | C27H27N3O6 |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | [(Z)-[amino-[4-(2-amino-2-oxoethoxy)phenyl]methylidene]amino] (Z)-3-[4-methoxy-3-[(4-methylphenoxy)methyl]phenyl]prop-2-enoate |
| SMILES | COc1ccc(/C=C\C(=O)O/N=C(\N)c2ccc(OCC(N)=O)cc2)cc1COc1ccc(C)cc1 |
| InChI | InChI=1S/C27H27N3O6/c1-18-3-9-22(10-4-18)34-16-21-15-19(5-13-24(21)33-2)6-14-26(32)36-30-27(29)20-7-11-23(12-8-20)35-17-25(28)31/h3-15H,16-17H2,1-2H3,(H2,28,31)(H2,29,30)/b14-6- |
| InChIKey | LNHZGQBOGJDIGN-NSIKDUERSA-N |
| XLogP | 3.32 |
| TPSA | 135.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|