C17H19N5O4 — CID 19295870
[(Z)-[amino-[4-(2-amino-2-oxoethoxy)phenyl]methylidene]amino] (E)-3-(1-ethylpyrazol-4-yl)prop-2-enoate (PubChem CID 19295870) has the molecular formula C17H19N5O4 and a molecular weight of 357.37 g/mol. Its IUPAC name is [(Z)-[amino-[4-(2-amino-2-oxoethoxy)phenyl]methylidene]amino] (E)-3-(1-ethylpyrazol-4-yl)prop-2-enoate.
| Compound Name | [(Z)-[amino-[4-(2-amino-2-oxoethoxy)phenyl]methylidene]amino] (E)-3-(1-ethylpyrazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 19295870 |
| Molecular Formula | C17H19N5O4 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | [(Z)-[amino-[4-(2-amino-2-oxoethoxy)phenyl]methylidene]amino] (E)-3-(1-ethylpyrazol-4-yl)prop-2-enoate |
| SMILES | CCn1cc(/C=C/C(=O)O/N=C(\N)c2ccc(OCC(N)=O)cc2)cn1 |
| InChI | InChI=1S/C17H19N5O4/c1-2-22-10-12(9-20-22)3-8-16(24)26-21-17(19)13-4-6-14(7-5-13)25-11-15(18)23/h3-10H,2,11H2,1H3,(H2,18,23)(H2,19,21)/b8-3+ |
| InChIKey | HMCCGMHUQHZPTO-FPYGCLRLSA-N |
| XLogP | 0.64 |
| TPSA | 134.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|