C15H16ClN5O4 — CID 51425409
[(E)-[amino-[4-(2-amino-2-oxoethoxy)phenyl]methylidene]amino] 4-chloro-1-ethylpyrazole-3-carboxylate (PubChem CID 51425409) has the molecular formula C15H16ClN5O4 and a molecular weight of 365.78 g/mol. Its IUPAC name is [(E)-[amino-[4-(2-amino-2-oxoethoxy)phenyl]methylidene]amino] 4-chloro-1-ethylpyrazole-3-carboxylate.
| Compound Name | [(E)-[amino-[4-(2-amino-2-oxoethoxy)phenyl]methylidene]amino] 4-chloro-1-ethylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 51425409 |
| Molecular Formula | C15H16ClN5O4 |
| Molecular Weight | 365.78 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | [(E)-[amino-[4-(2-amino-2-oxoethoxy)phenyl]methylidene]amino] 4-chloro-1-ethylpyrazole-3-carboxylate |
| SMILES | CCn1cc(Cl)c(C(=O)O/N=C(/N)c2ccc(OCC(N)=O)cc2)n1 |
| InChI | InChI=1S/C15H16ClN5O4/c1-2-21-7-11(16)13(19-21)15(23)25-20-14(18)9-3-5-10(6-4-9)24-8-12(17)22/h3-7H,2,8H2,1H3,(H2,17,22)(H2,18,20) |
| InChIKey | KHRLLPXBIKOBLV-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 134.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.78 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|