C20H17Cl2N5O5 — CID 19298429
[(Z)-[amino-[4-(2-amino-2-oxoethoxy)phenyl]methylidene]amino] 1-[(2,3-dichlorophenoxy)methyl]pyrazole-3-carboxylate (PubChem CID 19298429) has the molecular formula C20H17Cl2N5O5 and a molecular weight of 478.29 g/mol. Its IUPAC name is [(Z)-[amino-[4-(2-amino-2-oxoethoxy)phenyl]methylidene]amino] 1-[(2,3-dichlorophenoxy)methyl]pyrazole-3-carboxylate.
| Compound Name | [(Z)-[amino-[4-(2-amino-2-oxoethoxy)phenyl]methylidene]amino] 1-[(2,3-dichlorophenoxy)methyl]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 19298429 |
| Molecular Formula | C20H17Cl2N5O5 |
| Molecular Weight | 478.29 g/mol |
| Exact Mass | 477.06 |
| IUPAC Name | [(Z)-[amino-[4-(2-amino-2-oxoethoxy)phenyl]methylidene]amino] 1-[(2,3-dichlorophenoxy)methyl]pyrazole-3-carboxylate |
| SMILES | NC(=O)COc1ccc(/C(N)=N/OC(=O)c2ccn(COc3cccc(Cl)c3Cl)n2)cc1 |
| InChI | InChI=1S/C20H17Cl2N5O5/c21-14-2-1-3-16(18(14)22)31-11-27-9-8-15(25-27)20(29)32-26-19(24)12-4-6-13(7-5-12)30-10-17(23)28/h1-9H,10-11H2,(H2,23,28)(H2,24,26) |
| InChIKey | KXYDXVCOXGPCPH-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 144.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.29 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|