C21H22ClN5O3 — CID 19294137
[(Z)-[amino-(3-amino-2-methylphenyl)methylidene]amino] 1-[(4-chloro-3,5-dimethylphenoxy)methyl]pyrazole-3-carboxylate (PubChem CID 19294137) has the molecular formula C21H22ClN5O3 and a molecular weight of 427.89 g/mol. Its IUPAC name is [(Z)-[amino-(3-amino-2-methylphenyl)methylidene]amino] 1-[(4-chloro-3,5-dimethylphenoxy)methyl]pyrazole-3-carboxylate.
| Compound Name | [(Z)-[amino-(3-amino-2-methylphenyl)methylidene]amino] 1-[(4-chloro-3,5-dimethylphenoxy)methyl]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 19294137 |
| Molecular Formula | C21H22ClN5O3 |
| Molecular Weight | 427.89 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | [(Z)-[amino-(3-amino-2-methylphenyl)methylidene]amino] 1-[(4-chloro-3,5-dimethylphenoxy)methyl]pyrazole-3-carboxylate |
| SMILES | Cc1cc(OCn2ccc(C(=O)O/N=C(\N)c3cccc(N)c3C)n2)cc(C)c1Cl |
| InChI | InChI=1S/C21H22ClN5O3/c1-12-9-15(10-13(2)19(12)22)29-11-27-8-7-18(25-27)21(28)30-26-20(24)16-5-4-6-17(23)14(16)3/h4-10H,11,23H2,1-3H3,(H2,24,26) |
| InChIKey | PJGCCMREOGEGKU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 117.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.89 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|