C14H16N6O4 — CID 19294017
[(Z)-[amino-(3-amino-2-methylphenyl)methylidene]amino] 3-(3-nitropyrazol-1-yl)propanoate (PubChem CID 19294017) has the molecular formula C14H16N6O4 and a molecular weight of 332.32 g/mol. Its IUPAC name is [(Z)-[amino-(3-amino-2-methylphenyl)methylidene]amino] 3-(3-nitropyrazol-1-yl)propanoate.
| Compound Name | [(Z)-[amino-(3-amino-2-methylphenyl)methylidene]amino] 3-(3-nitropyrazol-1-yl)propanoate |
|---|---|
| PubChem CID | 19294017 |
| Molecular Formula | C14H16N6O4 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | [(Z)-[amino-(3-amino-2-methylphenyl)methylidene]amino] 3-(3-nitropyrazol-1-yl)propanoate |
| SMILES | Cc1c(N)cccc1/C(N)=N/OC(=O)CCn1ccc([N+](=O)[O-])n1 |
| InChI | InChI=1S/C14H16N6O4/c1-9-10(3-2-4-11(9)15)14(16)18-24-13(21)6-8-19-7-5-12(17-19)20(22)23/h2-5,7H,6,8,15H2,1H3,(H2,16,18) |
| InChIKey | GJHDGOJFUIZBHB-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 151.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|