C12H13N5O4S — CID 19324215
[(Z)-[amino(thiophen-2-yl)methylidene]amino] 3-(5-methyl-3-nitropyrazol-1-yl)propanoate (PubChem CID 19324215) has the molecular formula C12H13N5O4S and a molecular weight of 323.33 g/mol. Its IUPAC name is [(Z)-[amino(thiophen-2-yl)methylidene]amino] 3-(5-methyl-3-nitropyrazol-1-yl)propanoate.
| Compound Name | [(Z)-[amino(thiophen-2-yl)methylidene]amino] 3-(5-methyl-3-nitropyrazol-1-yl)propanoate |
|---|---|
| PubChem CID | 19324215 |
| Molecular Formula | C12H13N5O4S |
| Molecular Weight | 323.33 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | [(Z)-[amino(thiophen-2-yl)methylidene]amino] 3-(5-methyl-3-nitropyrazol-1-yl)propanoate |
| SMILES | Cc1cc([N+](=O)[O-])nn1CCC(=O)O/N=C(\N)c1cccs1 |
| InChI | InChI=1S/C12H13N5O4S/c1-8-7-10(17(19)20)14-16(8)5-4-11(18)21-15-12(13)9-3-2-6-22-9/h2-3,6-7H,4-5H2,1H3,(H2,13,15) |
| InChIKey | JYCGYYJLKOYLPD-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 125.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.33 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|