C15H17N5O4 — CID 19290123
[(Z)-[amino(phenyl)methylidene]amino] 2-methyl-3-(5-methyl-3-nitropyrazol-1-yl)propanoate (PubChem CID 19290123) has the molecular formula C15H17N5O4 and a molecular weight of 331.33 g/mol. Its IUPAC name is [(Z)-[amino(phenyl)methylidene]amino] 2-methyl-3-(5-methyl-3-nitropyrazol-1-yl)propanoate.
| Compound Name | [(Z)-[amino(phenyl)methylidene]amino] 2-methyl-3-(5-methyl-3-nitropyrazol-1-yl)propanoate |
|---|---|
| PubChem CID | 19290123 |
| Molecular Formula | C15H17N5O4 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | [(Z)-[amino(phenyl)methylidene]amino] 2-methyl-3-(5-methyl-3-nitropyrazol-1-yl)propanoate |
| SMILES | Cc1cc([N+](=O)[O-])nn1CC(C)C(=O)O/N=C(\N)c1ccccc1 |
| InChI | InChI=1S/C15H17N5O4/c1-10(9-19-11(2)8-13(17-19)20(22)23)15(21)24-18-14(16)12-6-4-3-5-7-12/h3-8,10H,9H2,1-2H3,(H2,16,18) |
| InChIKey | RRGKLTUDWCYTFU-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 125.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|