C15H16ClN5O5 — CID 19296066
[(Z)-[amino-(5-chloro-2-methoxyphenyl)methylidene]amino] 3-(5-methyl-3-nitropyrazol-1-yl)propanoate (PubChem CID 19296066) has the molecular formula C15H16ClN5O5 and a molecular weight of 381.78 g/mol. Its IUPAC name is [(Z)-[amino-(5-chloro-2-methoxyphenyl)methylidene]amino] 3-(5-methyl-3-nitropyrazol-1-yl)propanoate.
| Compound Name | [(Z)-[amino-(5-chloro-2-methoxyphenyl)methylidene]amino] 3-(5-methyl-3-nitropyrazol-1-yl)propanoate |
|---|---|
| PubChem CID | 19296066 |
| Molecular Formula | C15H16ClN5O5 |
| Molecular Weight | 381.78 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | [(Z)-[amino-(5-chloro-2-methoxyphenyl)methylidene]amino] 3-(5-methyl-3-nitropyrazol-1-yl)propanoate |
| SMILES | COc1ccc(Cl)cc1/C(N)=N/OC(=O)CCn1nc([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C15H16ClN5O5/c1-9-7-13(21(23)24)18-20(9)6-5-14(22)26-19-15(17)11-8-10(16)3-4-12(11)25-2/h3-4,7-8H,5-6H2,1-2H3,(H2,17,19) |
| InChIKey | QMVJKMRTJBNGJP-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 134.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.78 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|