C24H27Cl2N5O5 — CID 19296049
[(Z)-[amino-(5-chloro-2-methoxyphenyl)methylidene]amino] 2-[3-(4-chloro-5-methyl-3-nitropyrazol-1-yl)-1-adamantyl]acetate (PubChem CID 19296049) has the molecular formula C24H27Cl2N5O5 and a molecular weight of 536.42 g/mol. Its IUPAC name is [(Z)-[amino-(5-chloro-2-methoxyphenyl)methylidene]amino] 2-[3-(4-chloro-5-methyl-3-nitropyrazol-1-yl)-1-adamantyl]acetate.
| Compound Name | [(Z)-[amino-(5-chloro-2-methoxyphenyl)methylidene]amino] 2-[3-(4-chloro-5-methyl-3-nitropyrazol-1-yl)-1-adamantyl]acetate |
|---|---|
| PubChem CID | 19296049 |
| Molecular Formula | C24H27Cl2N5O5 |
| Molecular Weight | 536.42 g/mol |
| Exact Mass | 535.14 |
| IUPAC Name | [(Z)-[amino-(5-chloro-2-methoxyphenyl)methylidene]amino] 2-[3-(4-chloro-5-methyl-3-nitropyrazol-1-yl)-1-adamantyl]acetate |
| SMILES | COc1ccc(Cl)cc1/C(N)=N/OC(=O)CC12CC3CC(C1)CC(n1nc([N+](=O)[O-])c(Cl)c1C)(C3)C2 |
| InChI | InChI=1S/C24H27Cl2N5O5/c1-13-20(26)22(31(33)34)28-30(13)24-9-14-5-15(10-24)8-23(7-14,12-24)11-19(32)36-29-21(27)17-6-16(25)3-4-18(17)35-2/h3-4,6,14-15H,5,7-12H2,1-2H3,(H2,27,29) |
| InChIKey | UEYMYLBTABSXJW-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 134.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.42 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|