C23H25ClFN5O4 — CID 19291880
[(Z)-[amino-(4-fluorophenyl)methylidene]amino] 2-[3-(4-chloro-5-methyl-3-nitropyrazol-1-yl)-1-adamantyl]acetate (PubChem CID 19291880) has the molecular formula C23H25ClFN5O4 and a molecular weight of 489.94 g/mol. Its IUPAC name is [(Z)-[amino-(4-fluorophenyl)methylidene]amino] 2-[3-(4-chloro-5-methyl-3-nitropyrazol-1-yl)-1-adamantyl]acetate.
| Compound Name | [(Z)-[amino-(4-fluorophenyl)methylidene]amino] 2-[3-(4-chloro-5-methyl-3-nitropyrazol-1-yl)-1-adamantyl]acetate |
|---|---|
| PubChem CID | 19291880 |
| Molecular Formula | C23H25ClFN5O4 |
| Molecular Weight | 489.94 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | [(Z)-[amino-(4-fluorophenyl)methylidene]amino] 2-[3-(4-chloro-5-methyl-3-nitropyrazol-1-yl)-1-adamantyl]acetate |
| SMILES | Cc1c(Cl)c([N+](=O)[O-])nn1C12CC3CC(CC(CC(=O)O/N=C(\N)c4ccc(F)cc4)(C3)C1)C2 |
| InChI | InChI=1S/C23H25ClFN5O4/c1-13-19(24)21(30(32)33)27-29(13)23-9-14-6-15(10-23)8-22(7-14,12-23)11-18(31)34-28-20(26)16-2-4-17(25)5-3-16/h2-5,14-15H,6-12H2,1H3,(H2,26,28) |
| InChIKey | WMLLDSKYKIQSQH-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 125.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.94 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|