C24H27ClN6O3 — CID 19330562
3-[5-[[3-(4-chloro-5-methyl-3-nitropyrazol-1-yl)-1-adamantyl]methyl]-1,2,4-oxadiazol-3-yl]-2-methylaniline (PubChem CID 19330562) has the molecular formula C24H27ClN6O3 and a molecular weight of 482.97 g/mol. Its IUPAC name is 3-[5-[[3-(4-chloro-5-methyl-3-nitropyrazol-1-yl)-1-adamantyl]methyl]-1,2,4-oxadiazol-3-yl]-2-methylaniline.
| Compound Name | 3-[5-[[3-(4-chloro-5-methyl-3-nitropyrazol-1-yl)-1-adamantyl]methyl]-1,2,4-oxadiazol-3-yl]-2-methylaniline |
|---|---|
| PubChem CID | 19330562 |
| Molecular Formula | C24H27ClN6O3 |
| Molecular Weight | 482.97 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | 3-[5-[[3-(4-chloro-5-methyl-3-nitropyrazol-1-yl)-1-adamantyl]methyl]-1,2,4-oxadiazol-3-yl]-2-methylaniline |
| SMILES | Cc1c(N)cccc1-c1noc(CC23CC4CC(C2)CC(n2nc([N+](=O)[O-])c(Cl)c2C)(C4)C3)n1 |
| InChI | InChI=1S/C24H27ClN6O3/c1-13-17(4-3-5-18(13)26)21-27-19(34-29-21)11-23-7-15-6-16(8-23)10-24(9-15,12-23)30-14(2)20(25)22(28-30)31(32)33/h3-5,15-16H,6-12,26H2,1-2H3 |
| InChIKey | YJGPBHLRDLXLDN-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 125.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.97 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|