C15H16BrClN4O3 — CID 19296062
[(Z)-[amino-(5-chloro-2-methoxyphenyl)methylidene]amino] 3-(4-bromo-5-methylpyrazol-1-yl)propanoate (PubChem CID 19296062) has the molecular formula C15H16BrClN4O3 and a molecular weight of 415.68 g/mol. Its IUPAC name is [(Z)-[amino-(5-chloro-2-methoxyphenyl)methylidene]amino] 3-(4-bromo-5-methylpyrazol-1-yl)propanoate.
| Compound Name | [(Z)-[amino-(5-chloro-2-methoxyphenyl)methylidene]amino] 3-(4-bromo-5-methylpyrazol-1-yl)propanoate |
|---|---|
| PubChem CID | 19296062 |
| Molecular Formula | C15H16BrClN4O3 |
| Molecular Weight | 415.68 g/mol |
| Exact Mass | 414.01 |
| IUPAC Name | [(Z)-[amino-(5-chloro-2-methoxyphenyl)methylidene]amino] 3-(4-bromo-5-methylpyrazol-1-yl)propanoate |
| SMILES | COc1ccc(Cl)cc1/C(N)=N/OC(=O)CCn1ncc(Br)c1C |
| InChI | InChI=1S/C15H16BrClN4O3/c1-9-12(16)8-19-21(9)6-5-14(22)24-20-15(18)11-7-10(17)3-4-13(11)23-2/h3-4,7-8H,5-6H2,1-2H3,(H2,18,20) |
| InChIKey | KQRRNPWXNZMHQO-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.68 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|