C10H8Cl2F2N2O3 — CID 19296098
[(Z)-[amino-(5-chloro-2-methoxyphenyl)methylidene]amino] 2-chloro-2,2-difluoroacetate (PubChem CID 19296098) has the molecular formula C10H8Cl2F2N2O3 and a molecular weight of 313.09 g/mol. Its IUPAC name is [(Z)-[amino-(5-chloro-2-methoxyphenyl)methylidene]amino] 2-chloro-2,2-difluoroacetate.
| Compound Name | [(Z)-[amino-(5-chloro-2-methoxyphenyl)methylidene]amino] 2-chloro-2,2-difluoroacetate |
|---|---|
| PubChem CID | 19296098 |
| Molecular Formula | C10H8Cl2F2N2O3 |
| Molecular Weight | 313.09 g/mol |
| Exact Mass | 311.99 |
| IUPAC Name | [(Z)-[amino-(5-chloro-2-methoxyphenyl)methylidene]amino] 2-chloro-2,2-difluoroacetate |
| SMILES | COc1ccc(Cl)cc1/C(N)=N/OC(=O)C(F)(F)Cl |
| InChI | InChI=1S/C10H8Cl2F2N2O3/c1-18-7-3-2-5(11)4-6(7)8(15)16-19-9(17)10(12,13)14/h2-4H,1H3,(H2,15,16) |
| InChIKey | KENNUFPRIKXBRP-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.09 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|