C19H15ClF3N5O3 — CID 19296042
[(Z)-[amino-(5-chloro-2-methoxyphenyl)methylidene]amino] 5-cyclopropyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylate (PubChem CID 19296042) has the molecular formula C19H15ClF3N5O3 and a molecular weight of 453.81 g/mol. Its IUPAC name is [(Z)-[amino-(5-chloro-2-methoxyphenyl)methylidene]amino] 5-cyclopropyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylate.
| Compound Name | [(Z)-[amino-(5-chloro-2-methoxyphenyl)methylidene]amino] 5-cyclopropyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 19296042 |
| Molecular Formula | C19H15ClF3N5O3 |
| Molecular Weight | 453.81 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | [(Z)-[amino-(5-chloro-2-methoxyphenyl)methylidene]amino] 5-cyclopropyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylate |
| SMILES | COc1ccc(Cl)cc1/C(N)=N/OC(=O)c1cc2nc(C3CC3)cc(C(F)(F)F)n2n1 |
| InChI | InChI=1S/C19H15ClF3N5O3/c1-30-14-5-4-10(20)6-11(14)17(24)27-31-18(29)13-8-16-25-12(9-2-3-9)7-15(19(21,22)23)28(16)26-13/h4-9H,2-3H2,1H3,(H2,24,27) |
| InChIKey | HXDVBBXDSCTOOH-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 104.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.81 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|