C25H14Cl2F3N5O2 — CID 19293846
[(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 5-naphthalen-2-yl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylate (PubChem CID 19293846) has the molecular formula C25H14Cl2F3N5O2 and a molecular weight of 544.32 g/mol. Its IUPAC name is [(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 5-naphthalen-2-yl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylate.
| Compound Name | [(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 5-naphthalen-2-yl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 19293846 |
| Molecular Formula | C25H14Cl2F3N5O2 |
| Molecular Weight | 544.32 g/mol |
| Exact Mass | 543.05 |
| IUPAC Name | [(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 5-naphthalen-2-yl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylate |
| SMILES | N/C(=N\OC(=O)c1cc2nc(-c3ccc4ccccc4c3)cc(C(F)(F)F)n2n1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C25H14Cl2F3N5O2/c26-16-7-8-17(18(27)10-16)23(31)34-37-24(36)20-12-22-32-19(11-21(25(28,29)30)35(22)33-20)15-6-5-13-3-1-2-4-14(13)9-15/h1-12H,(H2,31,34) |
| InChIKey | HMZKXIGCMCFGOL-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 94.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.32 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|