C21H12ClF3N6O4 — CID 19298183
[(Z)-[amino-(4-nitrophenyl)methylidene]amino] 5-(4-chlorophenyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylate (PubChem CID 19298183) has the molecular formula C21H12ClF3N6O4 and a molecular weight of 504.81 g/mol. Its IUPAC name is [(Z)-[amino-(4-nitrophenyl)methylidene]amino] 5-(4-chlorophenyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylate.
| Compound Name | [(Z)-[amino-(4-nitrophenyl)methylidene]amino] 5-(4-chlorophenyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 19298183 |
| Molecular Formula | C21H12ClF3N6O4 |
| Molecular Weight | 504.81 g/mol |
| Exact Mass | 504.06 |
| IUPAC Name | [(Z)-[amino-(4-nitrophenyl)methylidene]amino] 5-(4-chlorophenyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylate |
| SMILES | N/C(=N\OC(=O)c1cc2nc(-c3ccc(Cl)cc3)cc(C(F)(F)F)n2n1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H12ClF3N6O4/c22-13-5-1-11(2-6-13)15-9-17(21(23,24)25)30-18(27-15)10-16(28-30)20(32)35-29-19(26)12-3-7-14(8-4-12)31(33)34/h1-10H,(H2,26,29) |
| InChIKey | VXGPLAKTKBLPPW-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 138.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.81 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|