C20H9Br2F4N5O3 — CID 19451710
N-(2,6-dibromo-4-nitrophenyl)-5-(4-fluorophenyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 19451710) has the molecular formula C20H9Br2F4N5O3 and a molecular weight of 603.12 g/mol. Its IUPAC name is N-(2,6-dibromo-4-nitrophenyl)-5-(4-fluorophenyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | N-(2,6-dibromo-4-nitrophenyl)-5-(4-fluorophenyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 19451710 |
| Molecular Formula | C20H9Br2F4N5O3 |
| Molecular Weight | 603.12 g/mol |
| Exact Mass | 600.90 |
| IUPAC Name | N-(2,6-dibromo-4-nitrophenyl)-5-(4-fluorophenyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | O=C(Nc1c(Br)cc([N+](=O)[O-])cc1Br)c1cc2nc(-c3ccc(F)cc3)cc(C(F)(F)F)n2n1 |
| InChI | InChI=1S/C20H9Br2F4N5O3/c21-12-5-11(31(33)34)6-13(22)18(12)28-19(32)15-8-17-27-14(9-1-3-10(23)4-2-9)7-16(20(24,25)26)30(17)29-15/h1-8H,(H,28,32) |
| InChIKey | UCCMTTIFPXHSIJ-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.12 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|