C27H17F4N5O4 — CID 19451804
5-(4-fluorophenyl)-N-[3-(3-methylphenoxy)-5-nitrophenyl]-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 19451804) has the molecular formula C27H17F4N5O4 and a molecular weight of 551.46 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N-[3-(3-methylphenoxy)-5-nitrophenyl]-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | 5-(4-fluorophenyl)-N-[3-(3-methylphenoxy)-5-nitrophenyl]-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 19451804 |
| Molecular Formula | C27H17F4N5O4 |
| Molecular Weight | 551.46 g/mol |
| Exact Mass | 551.12 |
| IUPAC Name | 5-(4-fluorophenyl)-N-[3-(3-methylphenoxy)-5-nitrophenyl]-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | Cc1cccc(Oc2cc(NC(=O)c3cc4nc(-c5ccc(F)cc5)cc(C(F)(F)F)n4n3)cc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C27H17F4N5O4/c1-15-3-2-4-20(9-15)40-21-11-18(10-19(12-21)36(38)39)32-26(37)23-14-25-33-22(16-5-7-17(28)8-6-16)13-24(27(29,30)31)35(25)34-23/h2-14H,1H3,(H,32,37) |
| InChIKey | MVVVPHJHTJFTJK-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 111.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.46 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|