C25H16F3N5O5S — CID 19453667
N-[3-(4-methoxyphenoxy)-5-nitrophenyl]-5-thiophen-2-yl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 19453667) has the molecular formula C25H16F3N5O5S and a molecular weight of 555.49 g/mol. Its IUPAC name is N-[3-(4-methoxyphenoxy)-5-nitrophenyl]-5-thiophen-2-yl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | N-[3-(4-methoxyphenoxy)-5-nitrophenyl]-5-thiophen-2-yl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 19453667 |
| Molecular Formula | C25H16F3N5O5S |
| Molecular Weight | 555.49 g/mol |
| Exact Mass | 555.08 |
| IUPAC Name | N-[3-(4-methoxyphenoxy)-5-nitrophenyl]-5-thiophen-2-yl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | COc1ccc(Oc2cc(NC(=O)c3cc4nc(-c5cccs5)cc(C(F)(F)F)n4n3)cc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C25H16F3N5O5S/c1-37-16-4-6-17(7-5-16)38-18-10-14(9-15(11-18)33(35)36)29-24(34)20-13-23-30-19(21-3-2-8-39-21)12-22(25(26,27)28)32(23)31-20/h2-13H,1H3,(H,29,34) |
| InChIKey | HXGVASLRXLNVDU-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 120.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.49 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|