C23H16F5N5O5 — CID 19455854
N-[3-(4-methoxyphenoxy)-5-nitrophenyl]-5-methyl-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 19455854) has the molecular formula C23H16F5N5O5 and a molecular weight of 537.40 g/mol. Its IUPAC name is N-[3-(4-methoxyphenoxy)-5-nitrophenyl]-5-methyl-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | N-[3-(4-methoxyphenoxy)-5-nitrophenyl]-5-methyl-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 19455854 |
| Molecular Formula | C23H16F5N5O5 |
| Molecular Weight | 537.40 g/mol |
| Exact Mass | 537.11 |
| IUPAC Name | N-[3-(4-methoxyphenoxy)-5-nitrophenyl]-5-methyl-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | COc1ccc(Oc2cc(NC(=O)c3cc4nc(C)cc(C(F)(F)C(F)(F)F)n4n3)cc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C23H16F5N5O5/c1-12-7-19(22(24,25)23(26,27)28)32-20(29-12)11-18(31-32)21(34)30-13-8-14(33(35)36)10-17(9-13)38-16-5-3-15(37-2)4-6-16/h3-11H,1-2H3,(H,30,34) |
| InChIKey | XEHVJTBHVPULMT-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 120.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.40 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|