C17H12F5N5O4 — CID 19455763
N-(4-methoxy-2-nitrophenyl)-5-methyl-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 19455763) has the molecular formula C17H12F5N5O4 and a molecular weight of 445.30 g/mol. Its IUPAC name is N-(4-methoxy-2-nitrophenyl)-5-methyl-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | N-(4-methoxy-2-nitrophenyl)-5-methyl-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 19455763 |
| Molecular Formula | C17H12F5N5O4 |
| Molecular Weight | 445.30 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | N-(4-methoxy-2-nitrophenyl)-5-methyl-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cc3nc(C)cc(C(F)(F)C(F)(F)F)n3n2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H12F5N5O4/c1-8-5-13(16(18,19)17(20,21)22)26-14(23-8)7-11(25-26)15(28)24-10-4-3-9(31-2)6-12(10)27(29)30/h3-7H,1-2H3,(H,24,28) |
| InChIKey | XJCLKCXRCHSUDJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 111.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.30 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|