C17H14ClF2N5O4 — CID 19458023
7-[chloro(difluoro)methyl]-N-(4-ethoxy-2-nitrophenyl)-5-methylpyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 19458023) has the molecular formula C17H14ClF2N5O4 and a molecular weight of 425.78 g/mol. Its IUPAC name is 7-[chloro(difluoro)methyl]-N-(4-ethoxy-2-nitrophenyl)-5-methylpyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | 7-[chloro(difluoro)methyl]-N-(4-ethoxy-2-nitrophenyl)-5-methylpyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 19458023 |
| Molecular Formula | C17H14ClF2N5O4 |
| Molecular Weight | 425.78 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | 7-[chloro(difluoro)methyl]-N-(4-ethoxy-2-nitrophenyl)-5-methylpyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | CCOc1ccc(NC(=O)c2cc3nc(C)cc(C(F)(F)Cl)n3n2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H14ClF2N5O4/c1-3-29-10-4-5-11(13(7-10)25(27)28)22-16(26)12-8-15-21-9(2)6-14(17(18,19)20)24(15)23-12/h4-8H,3H2,1-2H3,(H,22,26) |
| InChIKey | XQZMOPLVRGRSCU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 111.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.78 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|