C13H15ClF2N4O — CID 19459795
N-butyl-7-[chloro(difluoro)methyl]-5-methylpyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 19459795) has the molecular formula C13H15ClF2N4O and a molecular weight of 316.74 g/mol. Its IUPAC name is N-butyl-7-[chloro(difluoro)methyl]-5-methylpyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | N-butyl-7-[chloro(difluoro)methyl]-5-methylpyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 19459795 |
| Molecular Formula | C13H15ClF2N4O |
| Molecular Weight | 316.74 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | N-butyl-7-[chloro(difluoro)methyl]-5-methylpyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | CCCCNC(=O)c1cc2nc(C)cc(C(F)(F)Cl)n2n1 |
| InChI | InChI=1S/C13H15ClF2N4O/c1-3-4-5-17-12(21)9-7-11-18-8(2)6-10(13(14,15)16)20(11)19-9/h6-7H,3-5H2,1-2H3,(H,17,21) |
| InChIKey | VWVCDIYKZDIKRH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.74 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|