C16H15F5N6O — CID 19455773
N-[(1,5-dimethylpyrazol-4-yl)methyl]-5-methyl-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 19455773) has the molecular formula C16H15F5N6O and a molecular weight of 402.33 g/mol. Its IUPAC name is N-[(1,5-dimethylpyrazol-4-yl)methyl]-5-methyl-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | N-[(1,5-dimethylpyrazol-4-yl)methyl]-5-methyl-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 19455773 |
| Molecular Formula | C16H15F5N6O |
| Molecular Weight | 402.33 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | N-[(1,5-dimethylpyrazol-4-yl)methyl]-5-methyl-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | Cc1cc(C(F)(F)C(F)(F)F)n2nc(C(=O)NCc3cnn(C)c3C)cc2n1 |
| InChI | InChI=1S/C16H15F5N6O/c1-8-4-12(15(17,18)16(19,20)21)27-13(24-8)5-11(25-27)14(28)22-6-10-7-23-26(3)9(10)2/h4-5,7H,6H2,1-3H3,(H,22,28) |
| InChIKey | QEYYGXFMUBRRCJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 77.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|