C16H14BrF5N6O — CID 19455980
N-[(4-bromo-1-ethylpyrazol-5-yl)methyl]-5-methyl-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 19455980) has the molecular formula C16H14BrF5N6O and a molecular weight of 481.22 g/mol. Its IUPAC name is N-[(4-bromo-1-ethylpyrazol-5-yl)methyl]-5-methyl-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | N-[(4-bromo-1-ethylpyrazol-5-yl)methyl]-5-methyl-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 19455980 |
| Molecular Formula | C16H14BrF5N6O |
| Molecular Weight | 481.22 g/mol |
| Exact Mass | 480.03 |
| IUPAC Name | N-[(4-bromo-1-ethylpyrazol-5-yl)methyl]-5-methyl-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | CCn1ncc(Br)c1CNC(=O)c1cc2nc(C)cc(C(F)(F)C(F)(F)F)n2n1 |
| InChI | InChI=1S/C16H14BrF5N6O/c1-3-27-11(9(17)6-24-27)7-23-14(29)10-5-13-25-8(2)4-12(28(13)26-10)15(18,19)16(20,21)22/h4-6H,3,7H2,1-2H3,(H,23,29) |
| InChIKey | VXPFQNQQIRHUMC-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 77.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.22 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|