C17H17F5N6O — CID 19441024
N-[(2-ethylpyrazol-3-yl)methyl]-N,5-dimethyl-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 19441024) has the molecular formula C17H17F5N6O and a molecular weight of 416.35 g/mol. Its IUPAC name is N-[(2-ethylpyrazol-3-yl)methyl]-N,5-dimethyl-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | N-[(2-ethylpyrazol-3-yl)methyl]-N,5-dimethyl-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 19441024 |
| Molecular Formula | C17H17F5N6O |
| Molecular Weight | 416.35 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | N-[(2-ethylpyrazol-3-yl)methyl]-N,5-dimethyl-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | CCn1nccc1CN(C)C(=O)c1cc2nc(C)cc(C(F)(F)C(F)(F)F)n2n1 |
| InChI | InChI=1S/C17H17F5N6O/c1-4-27-11(5-6-23-27)9-26(3)15(29)12-8-14-24-10(2)7-13(28(14)25-12)16(18,19)17(20,21)22/h5-8H,4,9H2,1-3H3 |
| InChIKey | QPJJVKXOVLWHPO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 68.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|