C22H18BrF5N6O — CID 19455856
N-[3-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]phenyl]-5-methyl-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 19455856) has the molecular formula C22H18BrF5N6O and a molecular weight of 557.32 g/mol. Its IUPAC name is N-[3-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]phenyl]-5-methyl-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | N-[3-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]phenyl]-5-methyl-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 19455856 |
| Molecular Formula | C22H18BrF5N6O |
| Molecular Weight | 557.32 g/mol |
| Exact Mass | 556.06 |
| IUPAC Name | N-[3-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]phenyl]-5-methyl-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | Cc1cc(C(F)(F)C(F)(F)F)n2nc(C(=O)Nc3cccc(Cn4nc(C)c(Br)c4C)c3)cc2n1 |
| InChI | InChI=1S/C22H18BrF5N6O/c1-11-7-17(21(24,25)22(26,27)28)34-18(29-11)9-16(32-34)20(35)30-15-6-4-5-14(8-15)10-33-13(3)19(23)12(2)31-33/h4-9H,10H2,1-3H3,(H,30,35) |
| InChIKey | OPVBZQZYWSTYSE-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 77.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.32 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|