C16H11ClF2N6O5 — CID 19458118
7-[chloro(difluoro)methyl]-5-methyl-N-(4-methyl-3,5-dinitrophenyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 19458118) has the molecular formula C16H11ClF2N6O5 and a molecular weight of 440.75 g/mol. Its IUPAC name is 7-[chloro(difluoro)methyl]-5-methyl-N-(4-methyl-3,5-dinitrophenyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | 7-[chloro(difluoro)methyl]-5-methyl-N-(4-methyl-3,5-dinitrophenyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 19458118 |
| Molecular Formula | C16H11ClF2N6O5 |
| Molecular Weight | 440.75 g/mol |
| Exact Mass | 440.04 |
| IUPAC Name | 7-[chloro(difluoro)methyl]-5-methyl-N-(4-methyl-3,5-dinitrophenyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | Cc1cc(C(F)(F)Cl)n2nc(C(=O)Nc3cc([N+](=O)[O-])c(C)c([N+](=O)[O-])c3)cc2n1 |
| InChI | InChI=1S/C16H11ClF2N6O5/c1-7-3-13(16(17,18)19)23-14(20-7)6-10(22-23)15(26)21-9-4-11(24(27)28)8(2)12(5-9)25(29)30/h3-6H,1-2H3,(H,21,26) |
| InChIKey | TYFHRMJOOCUBFZ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 145.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.75 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|