C22H16F3N5O4 — CID 19449406
5-methyl-N-[3-(2-methylphenoxy)-5-nitrophenyl]-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 19449406) has the molecular formula C22H16F3N5O4 and a molecular weight of 471.40 g/mol. Its IUPAC name is 5-methyl-N-[3-(2-methylphenoxy)-5-nitrophenyl]-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | 5-methyl-N-[3-(2-methylphenoxy)-5-nitrophenyl]-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 19449406 |
| Molecular Formula | C22H16F3N5O4 |
| Molecular Weight | 471.40 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | 5-methyl-N-[3-(2-methylphenoxy)-5-nitrophenyl]-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | Cc1cc(C(F)(F)F)n2nc(C(=O)Nc3cc(Oc4ccccc4C)cc([N+](=O)[O-])c3)cc2n1 |
| InChI | InChI=1S/C22H16F3N5O4/c1-12-5-3-4-6-18(12)34-16-9-14(8-15(10-16)30(32)33)27-21(31)17-11-20-26-13(2)7-19(22(23,24)25)29(20)28-17/h3-11H,1-2H3,(H,27,31) |
| InChIKey | XDTSEPAUGIJMFU-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 111.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.40 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|