C18H14F2N6O5 — CID 19455605
5-cyclopropyl-7-(difluoromethyl)-N-(4-methyl-3,5-dinitrophenyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 19455605) has the molecular formula C18H14F2N6O5 and a molecular weight of 432.34 g/mol. Its IUPAC name is 5-cyclopropyl-7-(difluoromethyl)-N-(4-methyl-3,5-dinitrophenyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | 5-cyclopropyl-7-(difluoromethyl)-N-(4-methyl-3,5-dinitrophenyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 19455605 |
| Molecular Formula | C18H14F2N6O5 |
| Molecular Weight | 432.34 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | 5-cyclopropyl-7-(difluoromethyl)-N-(4-methyl-3,5-dinitrophenyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | Cc1c([N+](=O)[O-])cc(NC(=O)c2cc3nc(C4CC4)cc(C(F)F)n3n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H14F2N6O5/c1-8-13(25(28)29)4-10(5-14(8)26(30)31)21-18(27)12-7-16-22-11(9-2-3-9)6-15(17(19)20)24(16)23-12/h4-7,9,17H,2-3H2,1H3,(H,21,27) |
| InChIKey | KIBWLXCDHZLAIT-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 145.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.34 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|